C32H35FN6O — CID 139801400
4-amino-N-[2-[4-(4-fluorophenyl)piperazin-1-yl]ethyl]-N-(2-phenyl-4,5,6,7-tetrahydroindazol-3-yl)benzamide (PubChem CID 139801400) has the molecular formula C32H35FN6O and a molecular weight of 538.67 g/mol. Its IUPAC name is 4-amino-N-[2-[4-(4-fluorophenyl)piperazin-1-yl]ethyl]-N-(2-phenyl-4,5,6,7-tetrahydroindazol-3-yl)benzamide.
| Compound Name | 4-amino-N-[2-[4-(4-fluorophenyl)piperazin-1-yl]ethyl]-N-(2-phenyl-4,5,6,7-tetrahydroindazol-3-yl)benzamide |
|---|---|
| PubChem CID | 139801400 |
| Molecular Formula | C32H35FN6O |
| Molecular Weight | 538.67 g/mol |
| Exact Mass | 538.29 |
| IUPAC Name | 4-amino-N-[2-[4-(4-fluorophenyl)piperazin-1-yl]ethyl]-N-(2-phenyl-4,5,6,7-tetrahydroindazol-3-yl)benzamide |
| SMILES | Nc1ccc(C(=O)N(CCN2CCN(c3ccc(F)cc3)CC2)c2c3c(nn2-c2ccccc2)CCCC3)cc1 |
| InChI | InChI=1S/C32H35FN6O/c33-25-12-16-27(17-13-25)37-21-18-36(19-22-37)20-23-38(32(40)24-10-14-26(34)15-11-24)31-29-8-4-5-9-30(29)35-39(31)28-6-2-1-3-7-28/h1-3,6-7,10-17H,4-5,8-9,18-23,34H2 |
| InChIKey | CIKDVQQCNGZGQD-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 70.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.67 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|