C29H37N7O3 — CID 139801627
N-[2-[4-[4-(dimethylamino)phenyl]piperazin-1-yl]ethyl]-N-(2-methyl-4,5,6,7-tetrahydroindazol-3-yl)-4-nitrobenzamide (PubChem CID 139801627) has the molecular formula C29H37N7O3 and a molecular weight of 531.66 g/mol. Its IUPAC name is N-[2-[4-[4-(dimethylamino)phenyl]piperazin-1-yl]ethyl]-N-(2-methyl-4,5,6,7-tetrahydroindazol-3-yl)-4-nitrobenzamide.
| Compound Name | N-[2-[4-[4-(dimethylamino)phenyl]piperazin-1-yl]ethyl]-N-(2-methyl-4,5,6,7-tetrahydroindazol-3-yl)-4-nitrobenzamide |
|---|---|
| PubChem CID | 139801627 |
| Molecular Formula | C29H37N7O3 |
| Molecular Weight | 531.66 g/mol |
| Exact Mass | 531.30 |
| IUPAC Name | N-[2-[4-[4-(dimethylamino)phenyl]piperazin-1-yl]ethyl]-N-(2-methyl-4,5,6,7-tetrahydroindazol-3-yl)-4-nitrobenzamide |
| SMILES | CN(C)c1ccc(N2CCN(CCN(C(=O)c3ccc([N+](=O)[O-])cc3)c3c4c(nn3C)CCCC4)CC2)cc1 |
| InChI | InChI=1S/C29H37N7O3/c1-31(2)23-12-14-24(15-13-23)34-19-16-33(17-20-34)18-21-35(28-26-6-4-5-7-27(26)30-32(28)3)29(37)22-8-10-25(11-9-22)36(38)39/h8-15H,4-7,16-21H2,1-3H3 |
| InChIKey | QKBQJSYPZIUBQC-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 90.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.66 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|