C28H30FN5O3 — CID 139801631
N-[2-[4-(4-fluorophenyl)piperazin-1-yl]ethyl]-4-nitro-N-(5,6,7,8-tetrahydroisoquinolin-1-yl)benzamide (PubChem CID 139801631) has the molecular formula C28H30FN5O3 and a molecular weight of 503.58 g/mol. Its IUPAC name is N-[2-[4-(4-fluorophenyl)piperazin-1-yl]ethyl]-4-nitro-N-(5,6,7,8-tetrahydroisoquinolin-1-yl)benzamide.
| Compound Name | N-[2-[4-(4-fluorophenyl)piperazin-1-yl]ethyl]-4-nitro-N-(5,6,7,8-tetrahydroisoquinolin-1-yl)benzamide |
|---|---|
| PubChem CID | 139801631 |
| Molecular Formula | C28H30FN5O3 |
| Molecular Weight | 503.58 g/mol |
| Exact Mass | 503.23 |
| IUPAC Name | N-[2-[4-(4-fluorophenyl)piperazin-1-yl]ethyl]-4-nitro-N-(5,6,7,8-tetrahydroisoquinolin-1-yl)benzamide |
| SMILES | O=C(c1ccc([N+](=O)[O-])cc1)N(CCN1CCN(c2ccc(F)cc2)CC1)c1nccc2c1CCCC2 |
| InChI | InChI=1S/C28H30FN5O3/c29-23-7-11-24(12-8-23)32-18-15-31(16-19-32)17-20-33(27-26-4-2-1-3-21(26)13-14-30-27)28(35)22-5-9-25(10-6-22)34(36)37/h5-14H,1-4,15-20H2 |
| InChIKey | ZMWQSHJMVWNNEC-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 82.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.58 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|