C25H30FN7O — CID 139801456
4-amino-N-[2-[4-(4-fluorophenyl)piperazin-1-yl]ethyl]-N-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)benzamide (PubChem CID 139801456) has the molecular formula C25H30FN7O and a molecular weight of 463.56 g/mol. Its IUPAC name is 4-amino-N-[2-[4-(4-fluorophenyl)piperazin-1-yl]ethyl]-N-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)benzamide.
| Compound Name | 4-amino-N-[2-[4-(4-fluorophenyl)piperazin-1-yl]ethyl]-N-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)benzamide |
|---|---|
| PubChem CID | 139801456 |
| Molecular Formula | C25H30FN7O |
| Molecular Weight | 463.56 g/mol |
| Exact Mass | 463.25 |
| IUPAC Name | 4-amino-N-[2-[4-(4-fluorophenyl)piperazin-1-yl]ethyl]-N-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)benzamide |
| SMILES | Nc1ccc(C(=O)N(CCN2CCN(c3ccc(F)cc3)CC2)c2nnc3n2CCCC3)cc1 |
| InChI | InChI=1S/C25H30FN7O/c26-20-6-10-22(11-7-20)31-16-13-30(14-17-31)15-18-33(24(34)19-4-8-21(27)9-5-19)25-29-28-23-3-1-2-12-32(23)25/h4-11H,1-3,12-18,27H2 |
| InChIKey | VROYLSAFOUARIA-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 83.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.56 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|