C26H27N5O2S — CID 139804794
N-[1-[3-(2-cyanophenoxy)propyl]piperidin-4-yl]-3-methyl-7-thia-2,12-diazatricyclo[6.3.1.04,12]dodeca-1,3,5,8,10-pentaene-6-carboxamide (PubChem CID 139804794) has the molecular formula C26H27N5O2S and a molecular weight of 473.60 g/mol. Its IUPAC name is N-[1-[3-(2-cyanophenoxy)propyl]piperidin-4-yl]-3-methyl-7-thia-2,12-diazatricyclo[6.3.1.04,12]dodeca-1,3,5,8,10-pentaene-6-carboxamide.
| Compound Name | N-[1-[3-(2-cyanophenoxy)propyl]piperidin-4-yl]-3-methyl-7-thia-2,12-diazatricyclo[6.3.1.04,12]dodeca-1,3,5,8,10-pentaene-6-carboxamide |
|---|---|
| PubChem CID | 139804794 |
| Molecular Formula | C26H27N5O2S |
| Molecular Weight | 473.60 g/mol |
| Exact Mass | 473.19 |
| IUPAC Name | N-[1-[3-(2-cyanophenoxy)propyl]piperidin-4-yl]-3-methyl-7-thia-2,12-diazatricyclo[6.3.1.04,12]dodeca-1,3,5,8,10-pentaene-6-carboxamide |
| SMILES | Cc1nc2cccc3n2c1C=C(C(=O)NC1CCN(CCCOc2ccccc2C#N)CC1)S3 |
| InChI | InChI=1S/C26H27N5O2S/c1-18-21-16-23(34-25-9-4-8-24(28-18)31(21)25)26(32)29-20-10-13-30(14-11-20)12-5-15-33-22-7-3-2-6-19(22)17-27/h2-4,6-9,16,20H,5,10-15H2,1H3,(H,29,32) |
| InChIKey | GDTGUPUTYILXIV-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 82.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.60 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|