C27H29F3N2O4 — CID 141006320
N-[1-[3-[(3-oxo-2-propan-2-ylidene-1-benzofuran-4-yl)oxy]propyl]piperidin-4-yl]-4-(trifluoromethyl)benzamide (PubChem CID 141006320) has the molecular formula C27H29F3N2O4 and a molecular weight of 502.53 g/mol. Its IUPAC name is N-[1-[3-[(3-oxo-2-propan-2-ylidene-1-benzofuran-4-yl)oxy]propyl]piperidin-4-yl]-4-(trifluoromethyl)benzamide.
| Compound Name | N-[1-[3-[(3-oxo-2-propan-2-ylidene-1-benzofuran-4-yl)oxy]propyl]piperidin-4-yl]-4-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 141006320 |
| Molecular Formula | C27H29F3N2O4 |
| Molecular Weight | 502.53 g/mol |
| Exact Mass | 502.21 |
| IUPAC Name | N-[1-[3-[(3-oxo-2-propan-2-ylidene-1-benzofuran-4-yl)oxy]propyl]piperidin-4-yl]-4-(trifluoromethyl)benzamide |
| SMILES | CC(C)=C1Oc2cccc(OCCCN3CCC(NC(=O)c4ccc(C(F)(F)F)cc4)CC3)c2C1=O |
| InChI | InChI=1S/C27H29F3N2O4/c1-17(2)25-24(33)23-21(5-3-6-22(23)36-25)35-16-4-13-32-14-11-20(12-15-32)31-26(34)18-7-9-19(10-8-18)27(28,29)30/h3,5-10,20H,4,11-16H2,1-2H3,(H,31,34) |
| InChIKey | FBQGHXDNESQCMX-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.53 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|