C27H32BrN3O4 — CID 18363844
4-bromo-N-[1-[2-[2-[(3-oxo-2-propan-2-ylidene-1-benzofuran-4-yl)oxy]ethylamino]ethyl]piperidin-4-yl]benzamide (PubChem CID 18363844) has the molecular formula C27H32BrN3O4 and a molecular weight of 542.47 g/mol. Its IUPAC name is 4-bromo-N-[1-[2-[2-[(3-oxo-2-propan-2-ylidene-1-benzofuran-4-yl)oxy]ethylamino]ethyl]piperidin-4-yl]benzamide.
| Compound Name | 4-bromo-N-[1-[2-[2-[(3-oxo-2-propan-2-ylidene-1-benzofuran-4-yl)oxy]ethylamino]ethyl]piperidin-4-yl]benzamide |
|---|---|
| PubChem CID | 18363844 |
| Molecular Formula | C27H32BrN3O4 |
| Molecular Weight | 542.47 g/mol |
| Exact Mass | 541.16 |
| IUPAC Name | 4-bromo-N-[1-[2-[2-[(3-oxo-2-propan-2-ylidene-1-benzofuran-4-yl)oxy]ethylamino]ethyl]piperidin-4-yl]benzamide |
| SMILES | CC(C)=C1Oc2cccc(OCCNCCN3CCC(NC(=O)c4ccc(Br)cc4)CC3)c2C1=O |
| InChI | InChI=1S/C27H32BrN3O4/c1-18(2)26-25(32)24-22(4-3-5-23(24)35-26)34-17-13-29-12-16-31-14-10-21(11-15-31)30-27(33)19-6-8-20(28)9-7-19/h3-9,21,29H,10-17H2,1-2H3,(H,30,33) |
| InChIKey | WHCISYCYXGOSEY-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.47 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|