C27H33ClN4O6S — CID 18363847
4-chloro-N-[1-[2-[2-[(3-oxo-2-propan-2-ylidene-1-benzofuran-4-yl)oxy]ethylamino]ethyl]piperidin-4-yl]-3-sulfamoylbenzamide (PubChem CID 18363847) has the molecular formula C27H33ClN4O6S and a molecular weight of 577.10 g/mol. Its IUPAC name is 4-chloro-N-[1-[2-[2-[(3-oxo-2-propan-2-ylidene-1-benzofuran-4-yl)oxy]ethylamino]ethyl]piperidin-4-yl]-3-sulfamoylbenzamide.
| Compound Name | 4-chloro-N-[1-[2-[2-[(3-oxo-2-propan-2-ylidene-1-benzofuran-4-yl)oxy]ethylamino]ethyl]piperidin-4-yl]-3-sulfamoylbenzamide |
|---|---|
| PubChem CID | 18363847 |
| Molecular Formula | C27H33ClN4O6S |
| Molecular Weight | 577.10 g/mol |
| Exact Mass | 576.18 |
| IUPAC Name | 4-chloro-N-[1-[2-[2-[(3-oxo-2-propan-2-ylidene-1-benzofuran-4-yl)oxy]ethylamino]ethyl]piperidin-4-yl]-3-sulfamoylbenzamide |
| SMILES | CC(C)=C1Oc2cccc(OCCNCCN3CCC(NC(=O)c4ccc(Cl)c(S(N)(=O)=O)c4)CC3)c2C1=O |
| InChI | InChI=1S/C27H33ClN4O6S/c1-17(2)26-25(33)24-21(4-3-5-22(24)38-26)37-15-11-30-10-14-32-12-8-19(9-13-32)31-27(34)18-6-7-20(28)23(16-18)39(29,35)36/h3-7,16,19,30H,8-15H2,1-2H3,(H,31,34)(H2,29,35,36) |
| InChIKey | PRLNLLHUTIBMTD-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 140.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.10 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|