C38H38N2O7 — CID 139807096
3-N,4-N-bis(2-ethyl-3-methoxy-4-phenylmethoxyphenyl)furan-3,4-dicarboxamide (PubChem CID 139807096) has the molecular formula C38H38N2O7 and a molecular weight of 634.73 g/mol. Its IUPAC name is 3-N,4-N-bis(2-ethyl-3-methoxy-4-phenylmethoxyphenyl)furan-3,4-dicarboxamide.
| Compound Name | 3-N,4-N-bis(2-ethyl-3-methoxy-4-phenylmethoxyphenyl)furan-3,4-dicarboxamide |
|---|---|
| PubChem CID | 139807096 |
| Molecular Formula | C38H38N2O7 |
| Molecular Weight | 634.73 g/mol |
| Exact Mass | 634.27 |
| IUPAC Name | 3-N,4-N-bis(2-ethyl-3-methoxy-4-phenylmethoxyphenyl)furan-3,4-dicarboxamide |
| SMILES | CCc1c(NC(=O)c2cocc2C(=O)Nc2ccc(OCc3ccccc3)c(OC)c2CC)ccc(OCc2ccccc2)c1OC |
| InChI | InChI=1S/C38H38N2O7/c1-5-27-31(17-19-33(35(27)43-3)46-21-25-13-9-7-10-14-25)39-37(41)29-23-45-24-30(29)38(42)40-32-18-20-34(36(44-4)28(32)6-2)47-22-26-15-11-8-12-16-26/h7-20,23-24H,5-6,21-22H2,1-4H3,(H,39,41)(H,40,42) |
| InChIKey | HYLDTSHORQTUCZ-UHFFFAOYSA-N |
| XLogP | 8.08 |
| TPSA | 108.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.73 |
| LogP ≤ 5 | 8.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |