C23H32N2O3 — CID 139808372
phenyl N-[7-(5-ethyl-2-methoxy-6-methyl-3-pyridinyl)heptyl]carbamate (PubChem CID 139808372) has the molecular formula C23H32N2O3 and a molecular weight of 384.52 g/mol. Its IUPAC name is phenyl N-[7-(5-ethyl-2-methoxy-6-methyl-3-pyridinyl)heptyl]carbamate.
| Compound Name | phenyl N-[7-(5-ethyl-2-methoxy-6-methyl-3-pyridinyl)heptyl]carbamate |
|---|---|
| PubChem CID | 139808372 |
| Molecular Formula | C23H32N2O3 |
| Molecular Weight | 384.52 g/mol |
| Exact Mass | 384.24 |
| IUPAC Name | phenyl N-[7-(5-ethyl-2-methoxy-6-methyl-3-pyridinyl)heptyl]carbamate |
| SMILES | CCc1cc(CCCCCCCNC(=O)Oc2ccccc2)c(OC)nc1C |
| InChI | InChI=1S/C23H32N2O3/c1-4-19-17-20(22(27-3)25-18(19)2)13-9-6-5-7-12-16-24-23(26)28-21-14-10-8-11-15-21/h8,10-11,14-15,17H,4-7,9,12-13,16H2,1-3H3,(H,24,26) |
| InChIKey | UILUXWJQWKBIOP-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.52 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|