C34H31ClN2O8S — CID 139808627
4-[1-(1,3-benzodioxol-5-yl)-2-oxo-2-[[(E)-2-phenylethenyl]sulfonylamino]ethoxy]-N-[(3-chlorophenyl)methoxy]-3-propylbenzamide (PubChem CID 139808627) has the molecular formula C34H31ClN2O8S and a molecular weight of 663.15 g/mol. Its IUPAC name is 4-[1-(1,3-benzodioxol-5-yl)-2-oxo-2-[[(E)-2-phenylethenyl]sulfonylamino]ethoxy]-N-[(3-chlorophenyl)methoxy]-3-propylbenzamide.
| Compound Name | 4-[1-(1,3-benzodioxol-5-yl)-2-oxo-2-[[(E)-2-phenylethenyl]sulfonylamino]ethoxy]-N-[(3-chlorophenyl)methoxy]-3-propylbenzamide |
|---|---|
| PubChem CID | 139808627 |
| Molecular Formula | C34H31ClN2O8S |
| Molecular Weight | 663.15 g/mol |
| Exact Mass | 662.15 |
| IUPAC Name | 4-[1-(1,3-benzodioxol-5-yl)-2-oxo-2-[[(E)-2-phenylethenyl]sulfonylamino]ethoxy]-N-[(3-chlorophenyl)methoxy]-3-propylbenzamide |
| SMILES | CCCc1cc(C(=O)NOCc2cccc(Cl)c2)ccc1OC(C(=O)NS(=O)(=O)/C=C/c1ccccc1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C34H31ClN2O8S/c1-2-7-25-19-27(33(38)36-44-21-24-10-6-11-28(35)18-24)13-14-29(25)45-32(26-12-15-30-31(20-26)43-22-42-30)34(39)37-46(40,41)17-16-23-8-4-3-5-9-23/h3-6,8-20,32H,2,7,21-22H2,1H3,(H,36,38)(H,37,39)/b17-16+ |
| InChIKey | QJCLTELMSAOVBW-WUKNDPDISA-N |
| XLogP | 6.12 |
| TPSA | 129.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.15 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|