C19H38IO2P — CID 139809161
3-[tributyl(iodo)-λ5-phosphanyl]propyl 2-methylprop-2-enoate (PubChem CID 139809161) has the molecular formula C19H38IO2P and a molecular weight of 456.39 g/mol. Its IUPAC name is 3-[tributyl(iodo)-λ5-phosphanyl]propyl 2-methylprop-2-enoate.
| Compound Name | 3-[tributyl(iodo)-λ5-phosphanyl]propyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 139809161 |
| Molecular Formula | C19H38IO2P |
| Molecular Weight | 456.39 g/mol |
| Exact Mass | 456.17 |
| IUPAC Name | 3-[tributyl(iodo)-λ5-phosphanyl]propyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCCP(I)(CCCC)(CCCC)CCCC |
| InChI | InChI=1S/C19H38IO2P/c1-6-9-14-23(20,15-10-7-2,16-11-8-3)17-12-13-22-19(21)18(4)5/h4,6-17H2,1-3,5H3 |
| InChIKey | DZPBSKUGRJRSQA-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.39 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|