C23H44O3 — CID 139809425
(4-methyl-1-propan-2-ylcyclohexyl) 10,10-dimethylundecaneperoxoate (PubChem CID 139809425) has the molecular formula C23H44O3 and a molecular weight of 368.60 g/mol. Its IUPAC name is (4-methyl-1-propan-2-ylcyclohexyl) 10,10-dimethylundecaneperoxoate.
| Compound Name | (4-methyl-1-propan-2-ylcyclohexyl) 10,10-dimethylundecaneperoxoate |
|---|---|
| PubChem CID | 139809425 |
| Molecular Formula | C23H44O3 |
| Molecular Weight | 368.60 g/mol |
| Exact Mass | 368.33 |
| IUPAC Name | (4-methyl-1-propan-2-ylcyclohexyl) 10,10-dimethylundecaneperoxoate |
| SMILES | CC1CCC(OOC(=O)CCCCCCCCC(C)(C)C)(C(C)C)CC1 |
| InChI | InChI=1S/C23H44O3/c1-19(2)23(17-14-20(3)15-18-23)26-25-21(24)13-11-9-7-8-10-12-16-22(4,5)6/h19-20H,7-18H2,1-6H3 |
| InChIKey | BBIOOMAHIMWIEZ-UHFFFAOYSA-N |
| XLogP | 7.23 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.60 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|