C16H18ClN3O3S — CID 139810334
N-[2-(3-amino-4-hydroxyphenyl)-3-methyl-1H-indol-5-yl]methanesulfonamide;hydrochloride (PubChem CID 139810334) has the molecular formula C16H18ClN3O3S and a molecular weight of 367.86 g/mol. Its IUPAC name is N-[2-(3-amino-4-hydroxyphenyl)-3-methyl-1H-indol-5-yl]methanesulfonamide;hydrochloride.
| Compound Name | N-[2-(3-amino-4-hydroxyphenyl)-3-methyl-1H-indol-5-yl]methanesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 139810334 |
| Molecular Formula | C16H18ClN3O3S |
| Molecular Weight | 367.86 g/mol |
| Exact Mass | 367.08 |
| IUPAC Name | N-[2-(3-amino-4-hydroxyphenyl)-3-methyl-1H-indol-5-yl]methanesulfonamide;hydrochloride |
| SMILES | Cc1c(-c2ccc(O)c(N)c2)[nH]c2ccc(NS(C)(=O)=O)cc12.Cl |
| InChI | InChI=1S/C16H17N3O3S.ClH/c1-9-12-8-11(19-23(2,21)22)4-5-14(12)18-16(9)10-3-6-15(20)13(17)7-10;/h3-8,18-20H,17H2,1-2H3;1H |
| InChIKey | VEPBBLYREPJQTK-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 108.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.86 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|