C18H18N4O3S — CID 155817006
[(E)-[5-methyl-2-(4-methylsulfonylphenyl)-1H-indol-3-yl]methylideneamino]urea (PubChem CID 155817006) has the molecular formula C18H18N4O3S and a molecular weight of 370.43 g/mol. Its IUPAC name is [(E)-[5-methyl-2-(4-methylsulfonylphenyl)-1H-indol-3-yl]methylideneamino]urea.
| Compound Name | [(E)-[5-methyl-2-(4-methylsulfonylphenyl)-1H-indol-3-yl]methylideneamino]urea |
|---|---|
| PubChem CID | 155817006 |
| Molecular Formula | C18H18N4O3S |
| Molecular Weight | 370.43 g/mol |
| Exact Mass | 370.11 |
| IUPAC Name | [(E)-[5-methyl-2-(4-methylsulfonylphenyl)-1H-indol-3-yl]methylideneamino]urea |
| SMILES | Cc1ccc2[nH]c(-c3ccc(S(C)(=O)=O)cc3)c(/C=N/NC(N)=O)c2c1 |
| InChI | InChI=1S/C18H18N4O3S/c1-11-3-8-16-14(9-11)15(10-20-22-18(19)23)17(21-16)12-4-6-13(7-5-12)26(2,24)25/h3-10,21H,1-2H3,(H3,19,22,23)/b20-10+ |
| InChIKey | IHIITYCWKVVCDA-KEBDBYFISA-N |
| XLogP | 2.55 |
| TPSA | 117.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.43 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|