C17H17N5O2S — CID 155811139
2-[(E)-[2-(4-methylsulfonylphenyl)-1H-indol-3-yl]methylideneamino]guanidine (PubChem CID 155811139) has the molecular formula C17H17N5O2S and a molecular weight of 355.42 g/mol. Its IUPAC name is 2-[(E)-[2-(4-methylsulfonylphenyl)-1H-indol-3-yl]methylideneamino]guanidine.
| Compound Name | 2-[(E)-[2-(4-methylsulfonylphenyl)-1H-indol-3-yl]methylideneamino]guanidine |
|---|---|
| PubChem CID | 155811139 |
| Molecular Formula | C17H17N5O2S |
| Molecular Weight | 355.42 g/mol |
| Exact Mass | 355.11 |
| IUPAC Name | 2-[(E)-[2-(4-methylsulfonylphenyl)-1H-indol-3-yl]methylideneamino]guanidine |
| SMILES | CS(=O)(=O)c1ccc(-c2[nH]c3ccccc3c2/C=N/N=C(N)N)cc1 |
| InChI | InChI=1S/C17H17N5O2S/c1-25(23,24)12-8-6-11(7-9-12)16-14(10-20-22-17(18)19)13-4-2-3-5-15(13)21-16/h2-10,21H,1H3,(H4,18,19,22)/b20-10+ |
| InChIKey | ZUTUSTKJCILNJW-KEBDBYFISA-N |
| XLogP | 1.85 |
| TPSA | 126.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.42 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|