C22H18N2O3S — CID 162411750
N-(4-methylphenyl)sulfonyl-2-phenyl-1H-indole-3-carboxamide (PubChem CID 162411750) has the molecular formula C22H18N2O3S and a molecular weight of 390.46 g/mol. Its IUPAC name is N-(4-methylphenyl)sulfonyl-2-phenyl-1H-indole-3-carboxamide.
| Compound Name | N-(4-methylphenyl)sulfonyl-2-phenyl-1H-indole-3-carboxamide |
|---|---|
| PubChem CID | 162411750 |
| Molecular Formula | C22H18N2O3S |
| Molecular Weight | 390.46 g/mol |
| Exact Mass | 390.10 |
| IUPAC Name | N-(4-methylphenyl)sulfonyl-2-phenyl-1H-indole-3-carboxamide |
| SMILES | Cc1ccc(S(=O)(=O)NC(=O)c2c(-c3ccccc3)[nH]c3ccccc23)cc1 |
| InChI | InChI=1S/C22H18N2O3S/c1-15-11-13-17(14-12-15)28(26,27)24-22(25)20-18-9-5-6-10-19(18)23-21(20)16-7-3-2-4-8-16/h2-14,23H,1H3,(H,24,25) |
| InChIKey | RAZSHBDETWMYTR-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 79.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.46 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |