C19H19ClN2 — CID 139216022
N-butyl-1-[2-(4-chlorophenyl)-1H-indol-3-yl]methanimine (PubChem CID 139216022) has the molecular formula C19H19ClN2 and a molecular weight of 310.83 g/mol. Its IUPAC name is N-butyl-1-[2-(4-chlorophenyl)-1H-indol-3-yl]methanimine.
| Compound Name | N-butyl-1-[2-(4-chlorophenyl)-1H-indol-3-yl]methanimine |
|---|---|
| PubChem CID | 139216022 |
| Molecular Formula | C19H19ClN2 |
| Molecular Weight | 310.83 g/mol |
| Exact Mass | 310.12 |
| IUPAC Name | N-butyl-1-[2-(4-chlorophenyl)-1H-indol-3-yl]methanimine |
| SMILES | CCCC/N=C/c1c(-c2ccc(Cl)cc2)[nH]c2ccccc12 |
| InChI | InChI=1S/C19H19ClN2/c1-2-3-12-21-13-17-16-6-4-5-7-18(16)22-19(17)14-8-10-15(20)11-9-14/h4-11,13,22H,2-3,12H2,1H3/b21-13+ |
| InChIKey | YEHBIIAPIJRUTP-FYJGNVAPSA-N |
| XLogP | 5.71 |
| TPSA | 28.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.83 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|