C19H18ClN5 — CID 135847970
N-[(E)-[2-(4-chlorophenyl)-1H-indol-3-yl]methylideneamino]-N-methyl-4,5-dihydro-1H-imidazol-2-amine (PubChem CID 135847970) has the molecular formula C19H18ClN5 and a molecular weight of 351.84 g/mol. Its IUPAC name is N-[(E)-[2-(4-chlorophenyl)-1H-indol-3-yl]methylideneamino]-N-methyl-4,5-dihydro-1H-imidazol-2-amine.
| Compound Name | N-[(E)-[2-(4-chlorophenyl)-1H-indol-3-yl]methylideneamino]-N-methyl-4,5-dihydro-1H-imidazol-2-amine |
|---|---|
| PubChem CID | 135847970 |
| Molecular Formula | C19H18ClN5 |
| Molecular Weight | 351.84 g/mol |
| Exact Mass | 351.13 |
| IUPAC Name | N-[(E)-[2-(4-chlorophenyl)-1H-indol-3-yl]methylideneamino]-N-methyl-4,5-dihydro-1H-imidazol-2-amine |
| SMILES | CN(/N=C/c1c(-c2ccc(Cl)cc2)[nH]c2ccccc12)C1=NCCN1 |
| InChI | InChI=1S/C19H18ClN5/c1-25(19-21-10-11-22-19)23-12-16-15-4-2-3-5-17(15)24-18(16)13-6-8-14(20)9-7-13/h2-9,12,24H,10-11H2,1H3,(H,21,22)/b23-12+ |
| InChIKey | QDTDBXWWFGVDJI-FSJBWODESA-N |
| XLogP | 3.71 |
| TPSA | 55.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.84 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|