C15H17IN4 — CID 6519025
N-methyl-N-[(Z)-naphthalen-2-ylmethylideneamino]-4,5-dihydro-1H-imidazol-2-amine;hydroiodide (PubChem CID 6519025) has the molecular formula C15H17IN4 and a molecular weight of 380.23 g/mol. Its IUPAC name is N-methyl-N-[(Z)-naphthalen-2-ylmethylideneamino]-4,5-dihydro-1H-imidazol-2-amine;hydroiodide.
| Compound Name | N-methyl-N-[(Z)-naphthalen-2-ylmethylideneamino]-4,5-dihydro-1H-imidazol-2-amine;hydroiodide |
|---|---|
| PubChem CID | 6519025 |
| Molecular Formula | C15H17IN4 |
| Molecular Weight | 380.23 g/mol |
| Exact Mass | 380.05 |
| IUPAC Name | N-methyl-N-[(Z)-naphthalen-2-ylmethylideneamino]-4,5-dihydro-1H-imidazol-2-amine;hydroiodide |
| SMILES | CN(/N=C\c1ccc2ccccc2c1)C1=NCCN1.I |
| InChI | InChI=1S/C15H16N4.HI/c1-19(15-16-8-9-17-15)18-11-12-6-7-13-4-2-3-5-14(13)10-12;/h2-7,10-11H,8-9H2,1H3,(H,16,17);1H/b18-11-; |
| InChIKey | PGZSJIPFCIYABV-VVTVMFAVSA-N |
| XLogP | 2.68 |
| TPSA | 39.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.23 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|