C32H21ClN4O — CID 135951794
(E)-N-[4-[2-(4-chlorophenyl)-1H-indol-3-yl]-1,3-oxazol-2-yl]-1-(2-phenyl-1H-indol-3-yl)methanimine (PubChem CID 135951794) has the molecular formula C32H21ClN4O and a molecular weight of 513.00 g/mol. Its IUPAC name is (E)-N-[4-[2-(4-chlorophenyl)-1H-indol-3-yl]-1,3-oxazol-2-yl]-1-(2-phenyl-1H-indol-3-yl)methanimine.
| Compound Name | (E)-N-[4-[2-(4-chlorophenyl)-1H-indol-3-yl]-1,3-oxazol-2-yl]-1-(2-phenyl-1H-indol-3-yl)methanimine |
|---|---|
| PubChem CID | 135951794 |
| Molecular Formula | C32H21ClN4O |
| Molecular Weight | 513.00 g/mol |
| Exact Mass | 512.14 |
| IUPAC Name | (E)-N-[4-[2-(4-chlorophenyl)-1H-indol-3-yl]-1,3-oxazol-2-yl]-1-(2-phenyl-1H-indol-3-yl)methanimine |
| SMILES | Clc1ccc(-c2[nH]c3ccccc3c2-c2coc(/N=C/c3c(-c4ccccc4)[nH]c4ccccc34)n2)cc1 |
| InChI | InChI=1S/C32H21ClN4O/c33-22-16-14-21(15-17-22)31-29(24-11-5-7-13-27(24)36-31)28-19-38-32(37-28)34-18-25-23-10-4-6-12-26(23)35-30(25)20-8-2-1-3-9-20/h1-19,35-36H/b34-18+ |
| InChIKey | YLRLWPMBYSLHIO-FABQOPTDSA-N |
| XLogP | 9.04 |
| TPSA | 69.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.00 |
| LogP ≤ 5 | 9.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|