C32H20Cl2N6S — CID 135951819
N-(4-chlorophenyl)imino-N'-[4-[2-(4-chlorophenyl)-1H-indol-3-yl]-1,3-thiazol-2-yl]-1H-indole-3-carboximidamide (PubChem CID 135951819) has the molecular formula C32H20Cl2N6S and a molecular weight of 591.53 g/mol. Its IUPAC name is N-(4-chlorophenyl)imino-N'-[4-[2-(4-chlorophenyl)-1H-indol-3-yl]-1,3-thiazol-2-yl]-1H-indole-3-carboximidamide.
| Compound Name | N-(4-chlorophenyl)imino-N'-[4-[2-(4-chlorophenyl)-1H-indol-3-yl]-1,3-thiazol-2-yl]-1H-indole-3-carboximidamide |
|---|---|
| PubChem CID | 135951819 |
| Molecular Formula | C32H20Cl2N6S |
| Molecular Weight | 591.53 g/mol |
| Exact Mass | 590.08 |
| IUPAC Name | N-(4-chlorophenyl)imino-N'-[4-[2-(4-chlorophenyl)-1H-indol-3-yl]-1,3-thiazol-2-yl]-1H-indole-3-carboximidamide |
| SMILES | Clc1ccc(/N=N/C(=N\c2nc(-c3c(-c4ccc(Cl)cc4)[nH]c4ccccc34)cs2)c2c[nH]c3ccccc23)cc1 |
| InChI | InChI=1S/C32H20Cl2N6S/c33-20-11-9-19(10-12-20)30-29(24-6-2-4-8-27(24)36-30)28-18-41-32(37-28)38-31(40-39-22-15-13-21(34)14-16-22)25-17-35-26-7-3-1-5-23(25)26/h1-18,35-36H/b38-31-,40-39+ |
| InChIKey | KRBXOECKWOGMLV-VRBLBDQKSA-N |
| XLogP | 10.61 |
| TPSA | 81.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.53 |
| LogP ≤ 5 | 10.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|