C18H18FN5O2 — CID 139810550
10-cyclopropyl-3-fluoro-2-piperazin-1-yl-7H-pyrido[4,3-b][1,8]naphthyridine-5,6-dione (PubChem CID 139810550) has the molecular formula C18H18FN5O2 and a molecular weight of 355.37 g/mol. Its IUPAC name is 10-cyclopropyl-3-fluoro-2-piperazin-1-yl-7H-pyrido[4,3-b][1,8]naphthyridine-5,6-dione.
| Compound Name | 10-cyclopropyl-3-fluoro-2-piperazin-1-yl-7H-pyrido[4,3-b][1,8]naphthyridine-5,6-dione |
|---|---|
| PubChem CID | 139810550 |
| Molecular Formula | C18H18FN5O2 |
| Molecular Weight | 355.37 g/mol |
| Exact Mass | 355.14 |
| IUPAC Name | 10-cyclopropyl-3-fluoro-2-piperazin-1-yl-7H-pyrido[4,3-b][1,8]naphthyridine-5,6-dione |
| SMILES | O=c1[nH]ccc2c1c(=O)c1cc(F)c(N3CCNCC3)nc1n2C1CC1 |
| InChI | InChI=1S/C18H18FN5O2/c19-12-9-11-15(25)14-13(3-4-21-18(14)26)24(10-1-2-10)16(11)22-17(12)23-7-5-20-6-8-23/h3-4,9-10,20H,1-2,5-8H2,(H,21,26) |
| InChIKey | VCKXFXKHJCCFTD-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 83.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.37 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|