C15H18FN5O3 — CID 22632976
1-cyclopropyl-6-fluoro-3-hydroxy-7-(4-methylpiperazin-1-yl)pyrido[2,3-d]pyrimidine-2,4-dione (PubChem CID 22632976) has the molecular formula C15H18FN5O3 and a molecular weight of 335.34 g/mol. Its IUPAC name is 1-cyclopropyl-6-fluoro-3-hydroxy-7-(4-methylpiperazin-1-yl)pyrido[2,3-d]pyrimidine-2,4-dione.
| Compound Name | 1-cyclopropyl-6-fluoro-3-hydroxy-7-(4-methylpiperazin-1-yl)pyrido[2,3-d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 22632976 |
| Molecular Formula | C15H18FN5O3 |
| Molecular Weight | 335.34 g/mol |
| Exact Mass | 335.14 |
| IUPAC Name | 1-cyclopropyl-6-fluoro-3-hydroxy-7-(4-methylpiperazin-1-yl)pyrido[2,3-d]pyrimidine-2,4-dione |
| SMILES | CN1CCN(c2nc3c(cc2F)c(=O)n(O)c(=O)n3C2CC2)CC1 |
| InChI | InChI=1S/C15H18FN5O3/c1-18-4-6-19(7-5-18)13-11(16)8-10-12(17-13)20(9-2-3-9)15(23)21(24)14(10)22/h8-9,24H,2-7H2,1H3 |
| InChIKey | YQLBFOCPQXFRSN-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 83.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.34 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|