C19H24FN3O3 — CID 68590320
7-(cyclohexylamino)-1-cyclopentyl-6-fluoro-3-hydroxyquinazoline-2,4-dione (PubChem CID 68590320) has the molecular formula C19H24FN3O3 and a molecular weight of 361.42 g/mol. Its IUPAC name is 7-(cyclohexylamino)-1-cyclopentyl-6-fluoro-3-hydroxyquinazoline-2,4-dione.
| Compound Name | 7-(cyclohexylamino)-1-cyclopentyl-6-fluoro-3-hydroxyquinazoline-2,4-dione |
|---|---|
| PubChem CID | 68590320 |
| Molecular Formula | C19H24FN3O3 |
| Molecular Weight | 361.42 g/mol |
| Exact Mass | 361.18 |
| IUPAC Name | 7-(cyclohexylamino)-1-cyclopentyl-6-fluoro-3-hydroxyquinazoline-2,4-dione |
| SMILES | O=c1c2cc(F)c(NC3CCCCC3)cc2n(C2CCCC2)c(=O)n1O |
| InChI | InChI=1S/C19H24FN3O3/c20-15-10-14-17(11-16(15)21-12-6-2-1-3-7-12)22(13-8-4-5-9-13)19(25)23(26)18(14)24/h10-13,21,26H,1-9H2 |
| InChIKey | CLTGQPPGOKGDQT-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 76.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.42 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|