C29H36FN3O3 — CID 59311085
7-(cyclohexylamino)-1-cyclopentyl-6-fluoro-3-(3-phenylmethoxypropyl)quinazoline-2,4-dione (PubChem CID 59311085) has the molecular formula C29H36FN3O3 and a molecular weight of 493.62 g/mol. Its IUPAC name is 7-(cyclohexylamino)-1-cyclopentyl-6-fluoro-3-(3-phenylmethoxypropyl)quinazoline-2,4-dione.
| Compound Name | 7-(cyclohexylamino)-1-cyclopentyl-6-fluoro-3-(3-phenylmethoxypropyl)quinazoline-2,4-dione |
|---|---|
| PubChem CID | 59311085 |
| Molecular Formula | C29H36FN3O3 |
| Molecular Weight | 493.62 g/mol |
| Exact Mass | 493.27 |
| IUPAC Name | 7-(cyclohexylamino)-1-cyclopentyl-6-fluoro-3-(3-phenylmethoxypropyl)quinazoline-2,4-dione |
| SMILES | O=c1c2cc(F)c(NC3CCCCC3)cc2n(C2CCCC2)c(=O)n1CCCOCc1ccccc1 |
| InChI | InChI=1S/C29H36FN3O3/c30-25-18-24-27(19-26(25)31-22-12-5-2-6-13-22)33(23-14-7-8-15-23)29(35)32(28(24)34)16-9-17-36-20-21-10-3-1-4-11-21/h1,3-4,10-11,18-19,22-23,31H,2,5-9,12-17,20H2 |
| InChIKey | PQVIUOFPFVXHCA-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 65.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.62 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|