C23H32FN3O3 — CID 59311303
7-(cyclohexylamino)-1-cyclopentyl-6-fluoro-3-(4-hydroxybutyl)quinazoline-2,4-dione (PubChem CID 59311303) has the molecular formula C23H32FN3O3 and a molecular weight of 417.53 g/mol. Its IUPAC name is 7-(cyclohexylamino)-1-cyclopentyl-6-fluoro-3-(4-hydroxybutyl)quinazoline-2,4-dione.
| Compound Name | 7-(cyclohexylamino)-1-cyclopentyl-6-fluoro-3-(4-hydroxybutyl)quinazoline-2,4-dione |
|---|---|
| PubChem CID | 59311303 |
| Molecular Formula | C23H32FN3O3 |
| Molecular Weight | 417.53 g/mol |
| Exact Mass | 417.24 |
| IUPAC Name | 7-(cyclohexylamino)-1-cyclopentyl-6-fluoro-3-(4-hydroxybutyl)quinazoline-2,4-dione |
| SMILES | O=c1c2cc(F)c(NC3CCCCC3)cc2n(C2CCCC2)c(=O)n1CCCCO |
| InChI | InChI=1S/C23H32FN3O3/c24-19-14-18-21(15-20(19)25-16-8-2-1-3-9-16)27(17-10-4-5-11-17)23(30)26(22(18)29)12-6-7-13-28/h14-17,25,28H,1-13H2 |
| InChIKey | DMMDOTTXSUJHIT-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 76.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.53 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|