C25H34FN3O5 — CID 91115110
[7-(cyclohexylamino)-1-cyclopentyl-6-fluoro-2,4-dioxoquinazolin-3-yl] 3,3-dimethylbutaneperoxoate (PubChem CID 91115110) has the molecular formula C25H34FN3O5 and a molecular weight of 475.56 g/mol. Its IUPAC name is [7-(cyclohexylamino)-1-cyclopentyl-6-fluoro-2,4-dioxoquinazolin-3-yl] 3,3-dimethylbutaneperoxoate.
| Compound Name | [7-(cyclohexylamino)-1-cyclopentyl-6-fluoro-2,4-dioxoquinazolin-3-yl] 3,3-dimethylbutaneperoxoate |
|---|---|
| PubChem CID | 91115110 |
| Molecular Formula | C25H34FN3O5 |
| Molecular Weight | 475.56 g/mol |
| Exact Mass | 475.25 |
| IUPAC Name | [7-(cyclohexylamino)-1-cyclopentyl-6-fluoro-2,4-dioxoquinazolin-3-yl] 3,3-dimethylbutaneperoxoate |
| SMILES | CC(C)(C)CC(=O)OOn1c(=O)c2cc(F)c(NC3CCCCC3)cc2n(C2CCCC2)c1=O |
| InChI | InChI=1S/C25H34FN3O5/c1-25(2,3)15-22(30)33-34-29-23(31)18-13-19(26)20(27-16-9-5-4-6-10-16)14-21(18)28(24(29)32)17-11-7-8-12-17/h13-14,16-17,27H,4-12,15H2,1-3H3 |
| InChIKey | HAOTYTXXXLWRMP-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 91.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.56 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|