C15H16FIN4O3 — CID 70480613
6-fluoro-1-(1-iodoethyl)-4-oxo-7-piperazin-1-yl-1,8-naphthyridine-3-carboxylic acid (PubChem CID 70480613) has the molecular formula C15H16FIN4O3 and a molecular weight of 446.22 g/mol. Its IUPAC name is 6-fluoro-1-(1-iodoethyl)-4-oxo-7-piperazin-1-yl-1,8-naphthyridine-3-carboxylic acid.
| Compound Name | 6-fluoro-1-(1-iodoethyl)-4-oxo-7-piperazin-1-yl-1,8-naphthyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 70480613 |
| Molecular Formula | C15H16FIN4O3 |
| Molecular Weight | 446.22 g/mol |
| Exact Mass | 446.03 |
| IUPAC Name | 6-fluoro-1-(1-iodoethyl)-4-oxo-7-piperazin-1-yl-1,8-naphthyridine-3-carboxylic acid |
| SMILES | CC(I)n1cc(C(=O)O)c(=O)c2cc(F)c(N3CCNCC3)nc21 |
| InChI | InChI=1S/C15H16FIN4O3/c1-8(17)21-7-10(15(23)24)12(22)9-6-11(16)14(19-13(9)21)20-4-2-18-3-5-20/h6-8,18H,2-5H2,1H3,(H,23,24) |
| InChIKey | IAMAPIUBPPAXRL-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.22 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|