C15H26O3 — CID 139810612
(2-butyl-2-formylhexyl) 2-methylprop-2-enoate (PubChem CID 139810612) has the molecular formula C15H26O3 and a molecular weight of 254.37 g/mol. Its IUPAC name is (2-butyl-2-formylhexyl) 2-methylprop-2-enoate.
| Compound Name | (2-butyl-2-formylhexyl) 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 139810612 |
| Molecular Formula | C15H26O3 |
| Molecular Weight | 254.37 g/mol |
| Exact Mass | 254.19 |
| IUPAC Name | (2-butyl-2-formylhexyl) 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(C=O)(CCCC)CCCC |
| InChI | InChI=1S/C15H26O3/c1-5-7-9-15(11-16,10-8-6-2)12-18-14(17)13(3)4/h11H,3,5-10,12H2,1-2,4H3 |
| InChIKey | VXVLHQJEHZZPPH-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.37 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|