C15H21NO5 — CID 87467575
[2-isocyanato-2-(2-methylprop-2-enoyloxymethyl)pentyl] 2-methylprop-2-enoate (PubChem CID 87467575) has the molecular formula C15H21NO5 and a molecular weight of 295.34 g/mol. Its IUPAC name is [2-isocyanato-2-(2-methylprop-2-enoyloxymethyl)pentyl] 2-methylprop-2-enoate.
| Compound Name | [2-isocyanato-2-(2-methylprop-2-enoyloxymethyl)pentyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 87467575 |
| Molecular Formula | C15H21NO5 |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 295.14 |
| IUPAC Name | [2-isocyanato-2-(2-methylprop-2-enoyloxymethyl)pentyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(CCC)(COC(=O)C(=C)C)N=C=O |
| InChI | InChI=1S/C15H21NO5/c1-6-7-15(16-10-17,8-20-13(18)11(2)3)9-21-14(19)12(4)5/h2,4,6-9H2,1,3,5H3 |
| InChIKey | IKOAVIFANKNQEZ-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 82.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|