C11H16F4O2 — CID 18625086
[2-fluoro-2-(1,2,2-trifluoroethyl)pentyl] 2-methylprop-2-enoate (PubChem CID 18625086) has the molecular formula C11H16F4O2 and a molecular weight of 256.24 g/mol. Its IUPAC name is [2-fluoro-2-(1,2,2-trifluoroethyl)pentyl] 2-methylprop-2-enoate.
| Compound Name | [2-fluoro-2-(1,2,2-trifluoroethyl)pentyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 18625086 |
| Molecular Formula | C11H16F4O2 |
| Molecular Weight | 256.24 g/mol |
| Exact Mass | 256.11 |
| IUPAC Name | [2-fluoro-2-(1,2,2-trifluoroethyl)pentyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(F)(CCC)C(F)C(F)F |
| InChI | InChI=1S/C11H16F4O2/c1-4-5-11(15,8(12)9(13)14)6-17-10(16)7(2)3/h8-9H,2,4-6H2,1,3H3 |
| InChIKey | FDAXXQCPSCYEBA-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.24 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|