C16H17ClN2O4 — CID 139811030
methyl N-[4-[(2-chloro-6-methoxy-4-pyridinyl)methoxy]-2-methylphenyl]carbamate (PubChem CID 139811030) has the molecular formula C16H17ClN2O4 and a molecular weight of 336.78 g/mol. Its IUPAC name is methyl N-[4-[(2-chloro-6-methoxy-4-pyridinyl)methoxy]-2-methylphenyl]carbamate.
| Compound Name | methyl N-[4-[(2-chloro-6-methoxy-4-pyridinyl)methoxy]-2-methylphenyl]carbamate |
|---|---|
| PubChem CID | 139811030 |
| Molecular Formula | C16H17ClN2O4 |
| Molecular Weight | 336.78 g/mol |
| Exact Mass | 336.09 |
| IUPAC Name | methyl N-[4-[(2-chloro-6-methoxy-4-pyridinyl)methoxy]-2-methylphenyl]carbamate |
| SMILES | COC(=O)Nc1ccc(OCc2cc(Cl)nc(OC)c2)cc1C |
| InChI | InChI=1S/C16H17ClN2O4/c1-10-6-12(4-5-13(10)18-16(20)22-3)23-9-11-7-14(17)19-15(8-11)21-2/h4-8H,9H2,1-3H3,(H,18,20) |
| InChIKey | ROJQOHYEDZHQEV-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.78 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|