C19H19NO3S — CID 139811068
methyl N-[2-methyl-4-[(3-methyl-1-benzothiophen-2-yl)methoxy]phenyl]carbamate (PubChem CID 139811068) has the molecular formula C19H19NO3S and a molecular weight of 341.43 g/mol. Its IUPAC name is methyl N-[2-methyl-4-[(3-methyl-1-benzothiophen-2-yl)methoxy]phenyl]carbamate.
| Compound Name | methyl N-[2-methyl-4-[(3-methyl-1-benzothiophen-2-yl)methoxy]phenyl]carbamate |
|---|---|
| PubChem CID | 139811068 |
| Molecular Formula | C19H19NO3S |
| Molecular Weight | 341.43 g/mol |
| Exact Mass | 341.11 |
| IUPAC Name | methyl N-[2-methyl-4-[(3-methyl-1-benzothiophen-2-yl)methoxy]phenyl]carbamate |
| SMILES | COC(=O)Nc1ccc(OCc2sc3ccccc3c2C)cc1C |
| InChI | InChI=1S/C19H19NO3S/c1-12-10-14(8-9-16(12)20-19(21)22-3)23-11-18-13(2)15-6-4-5-7-17(15)24-18/h4-10H,11H2,1-3H3,(H,20,21) |
| InChIKey | NWXWINRUTCQHRF-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.43 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |