C21H18F5N3O3 — CID 139810981
methyl N-[2-methyl-4-[[3-(1,1,2,2,2-pentafluoroethyl)-1-phenylpyrazol-5-yl]methoxy]phenyl]carbamate (PubChem CID 139810981) has the molecular formula C21H18F5N3O3 and a molecular weight of 455.38 g/mol. Its IUPAC name is methyl N-[2-methyl-4-[[3-(1,1,2,2,2-pentafluoroethyl)-1-phenylpyrazol-5-yl]methoxy]phenyl]carbamate.
| Compound Name | methyl N-[2-methyl-4-[[3-(1,1,2,2,2-pentafluoroethyl)-1-phenylpyrazol-5-yl]methoxy]phenyl]carbamate |
|---|---|
| PubChem CID | 139810981 |
| Molecular Formula | C21H18F5N3O3 |
| Molecular Weight | 455.38 g/mol |
| Exact Mass | 455.13 |
| IUPAC Name | methyl N-[2-methyl-4-[[3-(1,1,2,2,2-pentafluoroethyl)-1-phenylpyrazol-5-yl]methoxy]phenyl]carbamate |
| SMILES | COC(=O)Nc1ccc(OCc2cc(C(F)(F)C(F)(F)F)nn2-c2ccccc2)cc1C |
| InChI | InChI=1S/C21H18F5N3O3/c1-13-10-16(8-9-17(13)27-19(30)31-2)32-12-15-11-18(20(22,23)21(24,25)26)28-29(15)14-6-4-3-5-7-14/h3-11H,12H2,1-2H3,(H,27,30) |
| InChIKey | RKARIRUWZNGPNX-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.38 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|