C15H17NO4S — CID 139811024
methyl N-[4-[(4-methoxythiophen-3-yl)methoxy]-2-methylphenyl]carbamate (PubChem CID 139811024) has the molecular formula C15H17NO4S and a molecular weight of 307.37 g/mol. Its IUPAC name is methyl N-[4-[(4-methoxythiophen-3-yl)methoxy]-2-methylphenyl]carbamate.
| Compound Name | methyl N-[4-[(4-methoxythiophen-3-yl)methoxy]-2-methylphenyl]carbamate |
|---|---|
| PubChem CID | 139811024 |
| Molecular Formula | C15H17NO4S |
| Molecular Weight | 307.37 g/mol |
| Exact Mass | 307.09 |
| IUPAC Name | methyl N-[4-[(4-methoxythiophen-3-yl)methoxy]-2-methylphenyl]carbamate |
| SMILES | COC(=O)Nc1ccc(OCc2cscc2OC)cc1C |
| InChI | InChI=1S/C15H17NO4S/c1-10-6-12(4-5-13(10)16-15(17)19-3)20-7-11-8-21-9-14(11)18-2/h4-6,8-9H,7H2,1-3H3,(H,16,17) |
| InChIKey | CNEYJGXIFRUWDE-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.37 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |