C26H25N3O9S — CID 139811794
methyl 3-[[(2R)-2-[(4-nitrophenyl)sulfonylamino]-5-oxo-5-phenylmethoxypentanoyl]amino]benzoate (PubChem CID 139811794) has the molecular formula C26H25N3O9S and a molecular weight of 555.57 g/mol. Its IUPAC name is methyl 3-[[(2R)-2-[(4-nitrophenyl)sulfonylamino]-5-oxo-5-phenylmethoxypentanoyl]amino]benzoate.
| Compound Name | methyl 3-[[(2R)-2-[(4-nitrophenyl)sulfonylamino]-5-oxo-5-phenylmethoxypentanoyl]amino]benzoate |
|---|---|
| PubChem CID | 139811794 |
| Molecular Formula | C26H25N3O9S |
| Molecular Weight | 555.57 g/mol |
| Exact Mass | 555.13 |
| IUPAC Name | methyl 3-[[(2R)-2-[(4-nitrophenyl)sulfonylamino]-5-oxo-5-phenylmethoxypentanoyl]amino]benzoate |
| SMILES | COC(=O)c1cccc(NC(=O)[C@@H](CCC(=O)OCc2ccccc2)NS(=O)(=O)c2ccc([N+](=O)[O-])cc2)c1 |
| InChI | InChI=1S/C26H25N3O9S/c1-37-26(32)19-8-5-9-20(16-19)27-25(31)23(14-15-24(30)38-17-18-6-3-2-4-7-18)28-39(35,36)22-12-10-21(11-13-22)29(33)34/h2-13,16,23,28H,14-15,17H2,1H3,(H,27,31)/t23-/m1/s1 |
| InChIKey | FZWHLLOZFKIDIR-HSZRJFAPSA-N |
| XLogP | 3.19 |
| TPSA | 171.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.57 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|