C22H34O4 — CID 139814458
2-[[2,5-bis(2-methylbutan-2-yl)-4-(oxiran-2-ylmethoxy)phenoxy]methyl]oxirane (PubChem CID 139814458) has the molecular formula C22H34O4 and a molecular weight of 362.51 g/mol. Its IUPAC name is 2-[[2,5-bis(2-methylbutan-2-yl)-4-(oxiran-2-ylmethoxy)phenoxy]methyl]oxirane.
| Compound Name | 2-[[2,5-bis(2-methylbutan-2-yl)-4-(oxiran-2-ylmethoxy)phenoxy]methyl]oxirane |
|---|---|
| PubChem CID | 139814458 |
| Molecular Formula | C22H34O4 |
| Molecular Weight | 362.51 g/mol |
| Exact Mass | 362.25 |
| IUPAC Name | 2-[[2,5-bis(2-methylbutan-2-yl)-4-(oxiran-2-ylmethoxy)phenoxy]methyl]oxirane |
| SMILES | CCC(C)(C)c1cc(OCC2CO2)c(C(C)(C)CC)cc1OCC1CO1 |
| InChI | InChI=1S/C22H34O4/c1-7-21(3,4)17-9-20(26-14-16-12-24-16)18(22(5,6)8-2)10-19(17)25-13-15-11-23-15/h9-10,15-16H,7-8,11-14H2,1-6H3 |
| InChIKey | GFIIWMPAPCEMGD-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 43.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.51 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|