C53H72O7S2 — CID 101207609
1,3-bis[2-tert-butyl-4-[5-tert-butyl-2-methyl-4-(oxiran-2-ylmethoxy)phenyl]sulfanyl-5-methylphenoxy]propan-2-ol (PubChem CID 101207609) has the molecular formula C53H72O7S2 and a molecular weight of 885.29 g/mol. Its IUPAC name is 1,3-bis[2-tert-butyl-4-[5-tert-butyl-2-methyl-4-(oxiran-2-ylmethoxy)phenyl]sulfanyl-5-methylphenoxy]propan-2-ol.
| Compound Name | 1,3-bis[2-tert-butyl-4-[5-tert-butyl-2-methyl-4-(oxiran-2-ylmethoxy)phenyl]sulfanyl-5-methylphenoxy]propan-2-ol |
|---|---|
| PubChem CID | 101207609 |
| Molecular Formula | C53H72O7S2 |
| Molecular Weight | 885.29 g/mol |
| Exact Mass | 884.47 |
| IUPAC Name | 1,3-bis[2-tert-butyl-4-[5-tert-butyl-2-methyl-4-(oxiran-2-ylmethoxy)phenyl]sulfanyl-5-methylphenoxy]propan-2-ol |
| SMILES | Cc1cc(OCC(O)COc2cc(C)c(Sc3cc(C(C)(C)C)c(OCC4CO4)cc3C)cc2C(C)(C)C)c(C(C)(C)C)cc1Sc1cc(C(C)(C)C)c(OCC2CO2)cc1C |
| InChI | InChI=1S/C53H72O7S2/c1-31-17-42(38(50(5,6)7)21-46(31)61-48-23-40(52(11,12)13)44(19-33(48)3)59-29-36-27-55-36)57-25-35(54)26-58-43-18-32(2)47(22-39(43)51(8,9)10)62-49-24-41(53(14,15)16)45(20-34(49)4)60-30-37-28-56-37/h17-24,35-37,54H,25-30H2,1-16H3 |
| InChIKey | NHIFADSIPVERMB-UHFFFAOYSA-N |
| XLogP | 12.79 |
| TPSA | 82.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 885.29 |
| LogP ≤ 5 | 12.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|