C12H13Br3O2 — CID 88693967
2-[[2-(1,1,2-tribromopropan-2-yl)phenoxy]methyl]oxirane (PubChem CID 88693967) has the molecular formula C12H13Br3O2 and a molecular weight of 428.95 g/mol. Its IUPAC name is 2-[[2-(1,1,2-tribromopropan-2-yl)phenoxy]methyl]oxirane.
| Compound Name | 2-[[2-(1,1,2-tribromopropan-2-yl)phenoxy]methyl]oxirane |
|---|---|
| PubChem CID | 88693967 |
| Molecular Formula | C12H13Br3O2 |
| Molecular Weight | 428.95 g/mol |
| Exact Mass | 425.85 |
| IUPAC Name | 2-[[2-(1,1,2-tribromopropan-2-yl)phenoxy]methyl]oxirane |
| SMILES | CC(Br)(c1ccccc1OCC1CO1)C(Br)Br |
| InChI | InChI=1S/C12H13Br3O2/c1-12(15,11(13)14)9-4-2-3-5-10(9)17-7-8-6-16-8/h2-5,8,11H,6-7H2,1H3 |
| InChIKey | ABQLDBCFEDURMP-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.95 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|