C23H17F2N — CID 139817624
5-[2-(4-butyl-2-fluorophenyl)ethynyl]-1-fluoronaphthalene-2-carbonitrile (PubChem CID 139817624) has the molecular formula C23H17F2N and a molecular weight of 345.39 g/mol. Its IUPAC name is 5-[2-(4-butyl-2-fluorophenyl)ethynyl]-1-fluoronaphthalene-2-carbonitrile.
| Compound Name | 5-[2-(4-butyl-2-fluorophenyl)ethynyl]-1-fluoronaphthalene-2-carbonitrile |
|---|---|
| PubChem CID | 139817624 |
| Molecular Formula | C23H17F2N |
| Molecular Weight | 345.39 g/mol |
| Exact Mass | 345.13 |
| IUPAC Name | 5-[2-(4-butyl-2-fluorophenyl)ethynyl]-1-fluoronaphthalene-2-carbonitrile |
| SMILES | CCCCc1ccc(C#Cc2cccc3c(F)c(C#N)ccc23)c(F)c1 |
| InChI | InChI=1S/C23H17F2N/c1-2-3-5-16-8-9-18(22(24)14-16)11-10-17-6-4-7-21-20(17)13-12-19(15-26)23(21)25/h4,6-9,12-14H,2-3,5H2,1H3 |
| InChIKey | ZGVGKWLUHDFTMI-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.39 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|