C23H14F3N — CID 139817622
5-[2-(4-but-3-enyl-2-fluorophenyl)ethynyl]-1,3-difluoronaphthalene-2-carbonitrile (PubChem CID 139817622) has the molecular formula C23H14F3N and a molecular weight of 361.37 g/mol. Its IUPAC name is 5-[2-(4-but-3-enyl-2-fluorophenyl)ethynyl]-1,3-difluoronaphthalene-2-carbonitrile.
| Compound Name | 5-[2-(4-but-3-enyl-2-fluorophenyl)ethynyl]-1,3-difluoronaphthalene-2-carbonitrile |
|---|---|
| PubChem CID | 139817622 |
| Molecular Formula | C23H14F3N |
| Molecular Weight | 361.37 g/mol |
| Exact Mass | 361.11 |
| IUPAC Name | 5-[2-(4-but-3-enyl-2-fluorophenyl)ethynyl]-1,3-difluoronaphthalene-2-carbonitrile |
| SMILES | C=CCCc1ccc(C#Cc2cccc3c(F)c(C#N)c(F)cc23)c(F)c1 |
| InChI | InChI=1S/C23H14F3N/c1-2-3-5-15-8-9-17(21(24)12-15)11-10-16-6-4-7-18-19(16)13-22(25)20(14-27)23(18)26/h2,4,6-9,12-13H,1,3,5H2 |
| InChIKey | SGXRPCVDYGCHJB-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.37 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|