C18H32N2O2 — CID 139818616
2-(3-aminopropyl)-8,8-dipropyl-2-azaspiro[4.5]decane-7,9-dione (PubChem CID 139818616) has the molecular formula C18H32N2O2 and a molecular weight of 308.47 g/mol. Its IUPAC name is 2-(3-aminopropyl)-8,8-dipropyl-2-azaspiro[4.5]decane-7,9-dione.
| Compound Name | 2-(3-aminopropyl)-8,8-dipropyl-2-azaspiro[4.5]decane-7,9-dione |
|---|---|
| PubChem CID | 139818616 |
| Molecular Formula | C18H32N2O2 |
| Molecular Weight | 308.47 g/mol |
| Exact Mass | 308.25 |
| IUPAC Name | 2-(3-aminopropyl)-8,8-dipropyl-2-azaspiro[4.5]decane-7,9-dione |
| SMILES | CCCC1(CCC)C(=O)CC2(CCN(CCCN)C2)CC1=O |
| InChI | InChI=1S/C18H32N2O2/c1-3-6-18(7-4-2)15(21)12-17(13-16(18)22)8-11-20(14-17)10-5-9-19/h3-14,19H2,1-2H3 |
| InChIKey | QAHCGQATNMOYLZ-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.47 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|