About 7-fluoroisochromen-1-one
7-fluoroisochromen-1-one (PubChem CID 139821040) has the molecular formula C9H5FO2
and a molecular weight of 164.13 g/mol. Its IUPAC name is 7-fluoroisochromen-1-one.
Molecular Properties
| Compound Name | 7-fluoroisochromen-1-one |
| PubChem CID | 139821040 |
| Molecular Formula | C9H5FO2 |
| Molecular Weight | 164.13 g/mol |
| Exact Mass | 164.03 |
| IUPAC Name | 7-fluoroisochromen-1-one |
| SMILES | O=c1occc2ccc(F)cc12 |
| InChI | InChI=1S/C9H5FO2/c10-7-2-1-6-3-4-12-9(11)8(6)5-7/h1-5H |
| InChIKey | IUIQJQFARWQQAK-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.13 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7-fluoroisochromen-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-fluoroisochromen-1-one?
The IUPAC name of 7-fluoroisochromen-1-one (CID 139821040) is 7-fluoroisochromen-1-one.
What is the SMILES notation for 7-fluoroisochromen-1-one?
The canonical SMILES for 7-fluoroisochromen-1-one is O=c1occc2ccc(F)cc12.
What is the InChIKey of 7-fluoroisochromen-1-one?
The InChIKey is IUIQJQFARWQQAK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H5FO2/c10-7-2-1-6-3-4-12-9(11)8(6)5-7/h1-5H.
What are the key properties of 7-fluoroisochromen-1-one?
7-fluoroisochromen-1-one has a molecular weight of 164.13 g/mol, XLogP of 1.93, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-fluoroisochromen-1-one is sourced from PubChem (CID 139821040), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).