C17H22F3NO4S — CID 139821531
1-[3-(trifluoromethyl)phenoxy]butan-2-yl N-acetyl-N-(2-methylsulfanylethyl)carbamate (PubChem CID 139821531) has the molecular formula C17H22F3NO4S and a molecular weight of 393.43 g/mol. Its IUPAC name is 1-[3-(trifluoromethyl)phenoxy]butan-2-yl N-acetyl-N-(2-methylsulfanylethyl)carbamate.
| Compound Name | 1-[3-(trifluoromethyl)phenoxy]butan-2-yl N-acetyl-N-(2-methylsulfanylethyl)carbamate |
|---|---|
| PubChem CID | 139821531 |
| Molecular Formula | C17H22F3NO4S |
| Molecular Weight | 393.43 g/mol |
| Exact Mass | 393.12 |
| IUPAC Name | 1-[3-(trifluoromethyl)phenoxy]butan-2-yl N-acetyl-N-(2-methylsulfanylethyl)carbamate |
| SMILES | CCC(COc1cccc(C(F)(F)F)c1)OC(=O)N(CCSC)C(C)=O |
| InChI | InChI=1S/C17H22F3NO4S/c1-4-14(25-16(23)21(12(2)22)8-9-26-3)11-24-15-7-5-6-13(10-15)17(18,19)20/h5-7,10,14H,4,8-9,11H2,1-3H3 |
| InChIKey | YLPWCIHMNALVJE-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.43 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |