C20H22F3NO3 — CID 11003436
1-[3-(trifluoromethyl)phenoxy]butan-2-yl N-(2-phenylethyl)carbamate (PubChem CID 11003436) has the molecular formula C20H22F3NO3 and a molecular weight of 381.39 g/mol. Its IUPAC name is 1-[3-(trifluoromethyl)phenoxy]butan-2-yl N-(2-phenylethyl)carbamate.
| Compound Name | 1-[3-(trifluoromethyl)phenoxy]butan-2-yl N-(2-phenylethyl)carbamate |
|---|---|
| PubChem CID | 11003436 |
| Molecular Formula | C20H22F3NO3 |
| Molecular Weight | 381.39 g/mol |
| Exact Mass | 381.16 |
| IUPAC Name | 1-[3-(trifluoromethyl)phenoxy]butan-2-yl N-(2-phenylethyl)carbamate |
| SMILES | CCC(COc1cccc(C(F)(F)F)c1)OC(=O)NCCc1ccccc1 |
| InChI | InChI=1S/C20H22F3NO3/c1-2-17(14-26-18-10-6-9-16(13-18)20(21,22)23)27-19(25)24-12-11-15-7-4-3-5-8-15/h3-10,13,17H,2,11-12,14H2,1H3,(H,24,25) |
| InChIKey | GYNIKSWZQMGVEP-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.39 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |