C20H22F3NO3 — CID 54269777
1-[3-(trifluoromethyl)phenoxy]butan-2-yl N-[(2-methylphenyl)methyl]carbamate (PubChem CID 54269777) has the molecular formula C20H22F3NO3 and a molecular weight of 381.39 g/mol. Its IUPAC name is 1-[3-(trifluoromethyl)phenoxy]butan-2-yl N-[(2-methylphenyl)methyl]carbamate.
| Compound Name | 1-[3-(trifluoromethyl)phenoxy]butan-2-yl N-[(2-methylphenyl)methyl]carbamate |
|---|---|
| PubChem CID | 54269777 |
| Molecular Formula | C20H22F3NO3 |
| Molecular Weight | 381.39 g/mol |
| Exact Mass | 381.16 |
| IUPAC Name | 1-[3-(trifluoromethyl)phenoxy]butan-2-yl N-[(2-methylphenyl)methyl]carbamate |
| SMILES | CCC(COc1cccc(C(F)(F)F)c1)OC(=O)NCc1ccccc1C |
| InChI | InChI=1S/C20H22F3NO3/c1-3-17(13-26-18-10-6-9-16(11-18)20(21,22)23)27-19(25)24-12-15-8-5-4-7-14(15)2/h4-11,17H,3,12-13H2,1-2H3,(H,24,25) |
| InChIKey | RJHZMLGGJSUWOC-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.39 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |