C18H19ClF3NO — CID 70499747
N-[(2-chlorophenyl)methyl]-2-[3-(trifluoromethyl)phenoxy]butan-1-amine (PubChem CID 70499747) has the molecular formula C18H19ClF3NO and a molecular weight of 357.80 g/mol. Its IUPAC name is N-[(2-chlorophenyl)methyl]-2-[3-(trifluoromethyl)phenoxy]butan-1-amine.
| Compound Name | N-[(2-chlorophenyl)methyl]-2-[3-(trifluoromethyl)phenoxy]butan-1-amine |
|---|---|
| PubChem CID | 70499747 |
| Molecular Formula | C18H19ClF3NO |
| Molecular Weight | 357.80 g/mol |
| Exact Mass | 357.11 |
| IUPAC Name | N-[(2-chlorophenyl)methyl]-2-[3-(trifluoromethyl)phenoxy]butan-1-amine |
| SMILES | CCC(CNCc1ccccc1Cl)Oc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C18H19ClF3NO/c1-2-15(12-23-11-13-6-3-4-9-17(13)19)24-16-8-5-7-14(10-16)18(20,21)22/h3-10,15,23H,2,11-12H2,1H3 |
| InChIKey | LTRZLUJATXFYEK-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.80 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |