C16H11Cl2NO3 — CID 139822476
4-[2-(3,5-dichlorophenoxy)ethyl]isoindole-1,3-dione (PubChem CID 139822476) has the molecular formula C16H11Cl2NO3 and a molecular weight of 336.17 g/mol. Its IUPAC name is 4-[2-(3,5-dichlorophenoxy)ethyl]isoindole-1,3-dione.
| Compound Name | 4-[2-(3,5-dichlorophenoxy)ethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 139822476 |
| Molecular Formula | C16H11Cl2NO3 |
| Molecular Weight | 336.17 g/mol |
| Exact Mass | 335.01 |
| IUPAC Name | 4-[2-(3,5-dichlorophenoxy)ethyl]isoindole-1,3-dione |
| SMILES | O=C1NC(=O)c2c(CCOc3cc(Cl)cc(Cl)c3)cccc21 |
| InChI | InChI=1S/C16H11Cl2NO3/c17-10-6-11(18)8-12(7-10)22-5-4-9-2-1-3-13-14(9)16(21)19-15(13)20/h1-3,6-8H,4-5H2,(H,19,20,21) |
| InChIKey | RRDYBKHCLLVMIB-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.17 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|