C12H7ClN2O2S — CID 161215359
4-[(2-chloro-1,3-thiazol-5-yl)methyl]isoindole-1,3-dione (PubChem CID 161215359) has the molecular formula C12H7ClN2O2S and a molecular weight of 278.72 g/mol. Its IUPAC name is 4-[(2-chloro-1,3-thiazol-5-yl)methyl]isoindole-1,3-dione.
| Compound Name | 4-[(2-chloro-1,3-thiazol-5-yl)methyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 161215359 |
| Molecular Formula | C12H7ClN2O2S |
| Molecular Weight | 278.72 g/mol |
| Exact Mass | 277.99 |
| IUPAC Name | 4-[(2-chloro-1,3-thiazol-5-yl)methyl]isoindole-1,3-dione |
| SMILES | O=C1NC(=O)c2c(Cc3cnc(Cl)s3)cccc21 |
| InChI | InChI=1S/C12H7ClN2O2S/c13-12-14-5-7(18-12)4-6-2-1-3-8-9(6)11(17)15-10(8)16/h1-3,5H,4H2,(H,15,16,17) |
| InChIKey | UWUBFPWRAOSPHY-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.72 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|